C21H19F3N4O2S — CID 17399192
2-[[4-[2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methyl]indolizine-1-carbonitrile (PubChem CID 17399192) has the molecular formula C21H19F3N4O2S and a molecular weight of 448.47 g/mol. Its IUPAC name is 2-[[4-[2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methyl]indolizine-1-carbonitrile.
| Compound Name | 2-[[4-[2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methyl]indolizine-1-carbonitrile |
|---|---|
| PubChem CID | 17399192 |
| Molecular Formula | C21H19F3N4O2S |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 2-[[4-[2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methyl]indolizine-1-carbonitrile |
| SMILES | N#Cc1c(CN2CCN(S(=O)(=O)c3ccccc3C(F)(F)F)CC2)cn2ccccc12 |
| InChI | InChI=1S/C21H19F3N4O2S/c22-21(23,24)18-5-1-2-7-20(18)31(29,30)28-11-9-26(10-12-28)14-16-15-27-8-4-3-6-19(27)17(16)13-25/h1-8,15H,9-12,14H2 |
| InChIKey | TUBZVJGZMFTGSQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 68.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |