C21H20ClFN4 — CID 17472695
2-[[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]methyl]indolizine-1-carbonitrile (PubChem CID 17472695) has the molecular formula C21H20ClFN4 and a molecular weight of 382.87 g/mol. Its IUPAC name is 2-[[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]methyl]indolizine-1-carbonitrile.
| Compound Name | 2-[[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]methyl]indolizine-1-carbonitrile |
|---|---|
| PubChem CID | 17472695 |
| Molecular Formula | C21H20ClFN4 |
| Molecular Weight | 382.87 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 2-[[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]methyl]indolizine-1-carbonitrile |
| SMILES | N#Cc1c(CN2CCN(Cc3c(F)cccc3Cl)CC2)cn2ccccc12 |
| InChI | InChI=1S/C21H20ClFN4/c22-19-4-3-5-20(23)18(19)15-26-10-8-25(9-11-26)13-16-14-27-7-2-1-6-21(27)17(16)12-24/h1-7,14H,8-11,13,15H2 |
| InChIKey | ABSLKLUSDBIXBL-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 34.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.87 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |