C16H23F3N3O3S+ — CID 8689855
(2S)-N-ethyl-2-[4-[2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-ium-1-yl]propanamide (PubChem CID 8689855) has the molecular formula C16H23F3N3O3S+ and a molecular weight of 394.44 g/mol. Its IUPAC name is (2S)-N-ethyl-2-[4-[2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-ium-1-yl]propanamide.
| Compound Name | (2S)-N-ethyl-2-[4-[2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-ium-1-yl]propanamide |
|---|---|
| PubChem CID | 8689855 |
| Molecular Formula | C16H23F3N3O3S+ |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | (2S)-N-ethyl-2-[4-[2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-ium-1-yl]propanamide |
| SMILES | CCNC(=O)[C@H](C)[NH+]1CCN(S(=O)(=O)c2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H22F3N3O3S/c1-3-20-15(23)12(2)21-8-10-22(11-9-21)26(24,25)14-7-5-4-6-13(14)16(17,18)19/h4-7,12H,3,8-11H2,1-2H3,(H,20,23)/p+1/t12-/m0/s1 |
| InChIKey | BITIQXUYPZFGCM-LBPRGKRZSA-O |
| XLogP | 0.12 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |