C20H22ClF3N2O4S — CID 42909793
1-(4-chlorophenoxy)-3-[4-[2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propan-2-ol (PubChem CID 42909793) has the molecular formula C20H22ClF3N2O4S and a molecular weight of 478.92 g/mol. Its IUPAC name is 1-(4-chlorophenoxy)-3-[4-[2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propan-2-ol.
| Compound Name | 1-(4-chlorophenoxy)-3-[4-[2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 42909793 |
| Molecular Formula | C20H22ClF3N2O4S |
| Molecular Weight | 478.92 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | 1-(4-chlorophenoxy)-3-[4-[2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]propan-2-ol |
| SMILES | O=S(=O)(c1ccccc1C(F)(F)F)N1CCN(CC(O)COc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H22ClF3N2O4S/c21-15-5-7-17(8-6-15)30-14-16(27)13-25-9-11-26(12-10-25)31(28,29)19-4-2-1-3-18(19)20(22,23)24/h1-8,16,27H,9-14H2 |
| InChIKey | OUUCURAUVUHRIQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.92 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |