About 2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-N-[4-(difluoromethoxy)phenyl]acetamide
2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-N-[4-(difluoromethoxy)phenyl]acetamide (PubChem CID 27194088) has the molecular formula C19H19Cl2F2N3O4S
and a molecular weight of 494.35 g/mol. Its IUPAC name is 2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-N-[4-(difluoromethoxy)phenyl]acetamide.
Molecular Properties
| Compound Name | 2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-N-[4-(difluoromethoxy)phenyl]acetamide |
| PubChem CID | 27194088 |
| Molecular Formula | C19H19Cl2F2N3O4S |
| Molecular Weight | 494.35 g/mol |
| Exact Mass | 493.04 |
| IUPAC Name | 2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-N-[4-(difluoromethoxy)phenyl]acetamide |
| SMILES | O=C(CN1CCN(S(=O)(=O)c2cccc(Cl)c2Cl)CC1)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C19H19Cl2F2N3O4S/c20-15-2-1-3-16(18(15)21)31(28,29)26-10-8-25(9-11-26)12-17(27)24-13-4-6-14(7-5-13)30-19(22)23/h1-7,19H,8-12H2,(H,24,27) |
| InChIKey | VJZOYVRXKYUXIE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 494.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-N-[4-(difluoromethoxy)phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-N-[4-(difluoromethoxy)phenyl]acetamide?
The IUPAC name of 2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-N-[4-(difluoromethoxy)phenyl]acetamide (CID 27194088) is 2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-N-[4-(difluoromethoxy)phenyl]acetamide.
What is the SMILES notation for 2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-N-[4-(difluoromethoxy)phenyl]acetamide?
The canonical SMILES for 2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-N-[4-(difluoromethoxy)phenyl]acetamide is O=C(CN1CCN(S(=O)(=O)c2cccc(Cl)c2Cl)CC1)Nc1ccc(OC(F)F)cc1.
What is the InChIKey of 2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-N-[4-(difluoromethoxy)phenyl]acetamide?
The InChIKey is VJZOYVRXKYUXIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19Cl2F2N3O4S/c20-15-2-1-3-16(18(15)21)31(28,29)26-10-8-25(9-11-26)12-17(27)24-13-4-6-14(7-5-13)30-19(22)23/h1-7,19H,8-12H2,(H,24,27).
What are the key properties of 2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-N-[4-(difluoromethoxy)phenyl]acetamide?
2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-N-[4-(difluoromethoxy)phenyl]acetamide has a molecular weight of 494.35 g/mol, XLogP of 3.54, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-N-[4-(difluoromethoxy)phenyl]acetamide is sourced from PubChem (CID 27194088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).