C13H17Cl2NO4S — CID 56908943
1-(2,6-dichlorophenyl)sulfonyl-4-(hydroxymethyl)azepan-4-ol (PubChem CID 56908943) has the molecular formula C13H17Cl2NO4S and a molecular weight of 354.26 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)sulfonyl-4-(hydroxymethyl)azepan-4-ol.
| Compound Name | 1-(2,6-dichlorophenyl)sulfonyl-4-(hydroxymethyl)azepan-4-ol |
|---|---|
| PubChem CID | 56908943 |
| Molecular Formula | C13H17Cl2NO4S |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 1-(2,6-dichlorophenyl)sulfonyl-4-(hydroxymethyl)azepan-4-ol |
| SMILES | O=S(=O)(c1c(Cl)cccc1Cl)N1CCCC(O)(CO)CC1 |
| InChI | InChI=1S/C13H17Cl2NO4S/c14-10-3-1-4-11(15)12(10)21(19,20)16-7-2-5-13(18,9-17)6-8-16/h1,3-4,17-18H,2,5-9H2 |
| InChIKey | NCFYCLALBVVLPC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |