C13H15Cl2NO4S — CID 104595612
1-(2,6-dichlorophenyl)sulfonyl-2-methylpiperidine-2-carboxylic acid (PubChem CID 104595612) has the molecular formula C13H15Cl2NO4S and a molecular weight of 352.24 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)sulfonyl-2-methylpiperidine-2-carboxylic acid.
| Compound Name | 1-(2,6-dichlorophenyl)sulfonyl-2-methylpiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 104595612 |
| Molecular Formula | C13H15Cl2NO4S |
| Molecular Weight | 352.24 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | 1-(2,6-dichlorophenyl)sulfonyl-2-methylpiperidine-2-carboxylic acid |
| SMILES | CC1(C(=O)O)CCCCN1S(=O)(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H15Cl2NO4S/c1-13(12(17)18)7-2-3-8-16(13)21(19,20)11-9(14)5-4-6-10(11)15/h4-6H,2-3,7-8H2,1H3,(H,17,18) |
| InChIKey | KURNAZVBIHCXHT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.24 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |