C19H21ClFNO4S — CID 155991213
1-(3-chlorophenyl)sulfonyl-4-[(4-fluorophenoxy)methyl]azepan-4-ol (PubChem CID 155991213) has the molecular formula C19H21ClFNO4S and a molecular weight of 413.90 g/mol. Its IUPAC name is 1-(3-chlorophenyl)sulfonyl-4-[(4-fluorophenoxy)methyl]azepan-4-ol.
| Compound Name | 1-(3-chlorophenyl)sulfonyl-4-[(4-fluorophenoxy)methyl]azepan-4-ol |
|---|---|
| PubChem CID | 155991213 |
| Molecular Formula | C19H21ClFNO4S |
| Molecular Weight | 413.90 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 1-(3-chlorophenyl)sulfonyl-4-[(4-fluorophenoxy)methyl]azepan-4-ol |
| SMILES | O=S(=O)(c1cccc(Cl)c1)N1CCCC(O)(COc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H21ClFNO4S/c20-15-3-1-4-18(13-15)27(24,25)22-11-2-9-19(23,10-12-22)14-26-17-7-5-16(21)6-8-17/h1,3-8,13,23H,2,9-12,14H2 |
| InChIKey | QPDPLDJAXZGBQW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.90 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |