C15H21N4O3S+ — CID 4122064
N-[4-[4-(2-cyanoethyl)piperazin-4-ium-1-yl]sulfonylphenyl]acetamide (PubChem CID 4122064) has the molecular formula C15H21N4O3S+ and a molecular weight of 337.43 g/mol. Its IUPAC name is N-[4-[4-(2-cyanoethyl)piperazin-4-ium-1-yl]sulfonylphenyl]acetamide.
| Compound Name | N-[4-[4-(2-cyanoethyl)piperazin-4-ium-1-yl]sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 4122064 |
| Molecular Formula | C15H21N4O3S+ |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | N-[4-[4-(2-cyanoethyl)piperazin-4-ium-1-yl]sulfonylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2CC[NH+](CCC#N)CC2)cc1 |
| InChI | InChI=1S/C15H20N4O3S/c1-13(20)17-14-3-5-15(6-4-14)23(21,22)19-11-9-18(10-12-19)8-2-7-16/h3-6H,2,8-12H2,1H3,(H,17,20)/p+1 |
| InChIKey | XDMZOYCQHFMJMC-UHFFFAOYSA-O |
| XLogP | -0.55 |
| TPSA | 94.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |