C24H21NO5S2 — CID 68878898
4-[3-(4-ethylsulfonylphenoxy)phenyl]-8-methylsulfonylquinoline (PubChem CID 68878898) has the molecular formula C24H21NO5S2 and a molecular weight of 467.57 g/mol. Its IUPAC name is 4-[3-(4-ethylsulfonylphenoxy)phenyl]-8-methylsulfonylquinoline.
| Compound Name | 4-[3-(4-ethylsulfonylphenoxy)phenyl]-8-methylsulfonylquinoline |
|---|---|
| PubChem CID | 68878898 |
| Molecular Formula | C24H21NO5S2 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | 4-[3-(4-ethylsulfonylphenoxy)phenyl]-8-methylsulfonylquinoline |
| SMILES | CCS(=O)(=O)c1ccc(Oc2cccc(-c3ccnc4c(S(C)(=O)=O)cccc34)c2)cc1 |
| InChI | InChI=1S/C24H21NO5S2/c1-3-32(28,29)20-12-10-18(11-13-20)30-19-7-4-6-17(16-19)21-14-15-25-24-22(21)8-5-9-23(24)31(2,26)27/h4-16H,3H2,1-2H3 |
| InChIKey | DPOFESCIHVPMMW-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 90.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |