About [3-[[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]methylamino]phenyl]methanol
[3-[[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]methylamino]phenyl]methanol (PubChem CID 24857339) has the molecular formula C21H19N3O
and a molecular weight of 329.40 g/mol. Its IUPAC name is [3-[[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]methylamino]phenyl]methanol.
Molecular Properties
| Compound Name | [3-[[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]methylamino]phenyl]methanol |
| PubChem CID | 24857339 |
| Molecular Formula | C21H19N3O |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | [3-[[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]methylamino]phenyl]methanol |
| SMILES | OCc1cccc(NCc2ccc(-c3ccnc4[nH]ccc34)cc2)c1 |
| InChI | InChI=1S/C21H19N3O/c25-14-16-2-1-3-18(12-16)24-13-15-4-6-17(7-5-15)19-8-10-22-21-20(19)9-11-23-21/h1-12,24-25H,13-14H2,(H,22,23) |
| InChIKey | VJGPPGQUFNKDHH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-[[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]methylamino]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]methylamino]phenyl]methanol?
The IUPAC name of [3-[[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]methylamino]phenyl]methanol (CID 24857339) is [3-[[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]methylamino]phenyl]methanol.
What is the SMILES notation for [3-[[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]methylamino]phenyl]methanol?
The canonical SMILES for [3-[[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]methylamino]phenyl]methanol is OCc1cccc(NCc2ccc(-c3ccnc4[nH]ccc34)cc2)c1.
What is the InChIKey of [3-[[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]methylamino]phenyl]methanol?
The InChIKey is VJGPPGQUFNKDHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N3O/c25-14-16-2-1-3-18(12-16)24-13-15-4-6-17(7-5-15)19-8-10-22-21-20(19)9-11-23-21/h1-12,24-25H,13-14H2,(H,22,23).
What are the key properties of [3-[[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]methylamino]phenyl]methanol?
[3-[[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]methylamino]phenyl]methanol has a molecular weight of 329.40 g/mol, XLogP of 4.33, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]methylamino]phenyl]methanol is sourced from PubChem (CID 24857339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).