C23H14F3NO2 — CID 87202387
2-[4-(3-hydroxyphenyl)-8-(trifluoromethyl)quinolin-3-yl]benzaldehyde (PubChem CID 87202387) has the molecular formula C23H14F3NO2 and a molecular weight of 393.36 g/mol. Its IUPAC name is 2-[4-(3-hydroxyphenyl)-8-(trifluoromethyl)quinolin-3-yl]benzaldehyde.
| Compound Name | 2-[4-(3-hydroxyphenyl)-8-(trifluoromethyl)quinolin-3-yl]benzaldehyde |
|---|---|
| PubChem CID | 87202387 |
| Molecular Formula | C23H14F3NO2 |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 2-[4-(3-hydroxyphenyl)-8-(trifluoromethyl)quinolin-3-yl]benzaldehyde |
| SMILES | O=Cc1ccccc1-c1cnc2c(C(F)(F)F)cccc2c1-c1cccc(O)c1 |
| InChI | InChI=1S/C23H14F3NO2/c24-23(25,26)20-10-4-9-18-21(14-6-3-7-16(29)11-14)19(12-27-22(18)20)17-8-2-1-5-15(17)13-28/h1-13,29H |
| InChIKey | RDRHVYCQKKSRFZ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|