C27H17F3N2O2 — CID 174504655
4-[3-(quinolin-2-ylmethoxy)phenyl]-8-(trifluoromethyl)quinoline-3-carbaldehyde (PubChem CID 174504655) has the molecular formula C27H17F3N2O2 and a molecular weight of 458.44 g/mol. Its IUPAC name is 4-[3-(quinolin-2-ylmethoxy)phenyl]-8-(trifluoromethyl)quinoline-3-carbaldehyde.
| Compound Name | 4-[3-(quinolin-2-ylmethoxy)phenyl]-8-(trifluoromethyl)quinoline-3-carbaldehyde |
|---|---|
| PubChem CID | 174504655 |
| Molecular Formula | C27H17F3N2O2 |
| Molecular Weight | 458.44 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 4-[3-(quinolin-2-ylmethoxy)phenyl]-8-(trifluoromethyl)quinoline-3-carbaldehyde |
| SMILES | O=Cc1cnc2c(C(F)(F)F)cccc2c1-c1cccc(OCc2ccc3ccccc3n2)c1 |
| InChI | InChI=1S/C27H17F3N2O2/c28-27(29,30)23-9-4-8-22-25(19(15-33)14-31-26(22)23)18-6-3-7-21(13-18)34-16-20-12-11-17-5-1-2-10-24(17)32-20/h1-15H,16H2 |
| InChIKey | FOUACPWHOJPNJS-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.44 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|