C23H15ClF3NO — CID 66913406
4-(4-chloro-3-methoxyphenyl)-3-phenyl-8-(trifluoromethyl)quinoline (PubChem CID 66913406) has the molecular formula C23H15ClF3NO and a molecular weight of 413.83 g/mol. Its IUPAC name is 4-(4-chloro-3-methoxyphenyl)-3-phenyl-8-(trifluoromethyl)quinoline.
| Compound Name | 4-(4-chloro-3-methoxyphenyl)-3-phenyl-8-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 66913406 |
| Molecular Formula | C23H15ClF3NO |
| Molecular Weight | 413.83 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | 4-(4-chloro-3-methoxyphenyl)-3-phenyl-8-(trifluoromethyl)quinoline |
| SMILES | COc1cc(-c2c(-c3ccccc3)cnc3c(C(F)(F)F)cccc23)ccc1Cl |
| InChI | InChI=1S/C23H15ClF3NO/c1-29-20-12-15(10-11-19(20)24)21-16-8-5-9-18(23(25,26)27)22(16)28-13-17(21)14-6-3-2-4-7-14/h2-13H,1H3 |
| InChIKey | HZFDWIINOPPKJF-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.83 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |