C36H30F3NO6 — CID 91163105
[1-[4-[[3-[3-benzyl-8-(trifluoromethyl)quinolin-4-yl]phenyl]methoxy]phenyl]peroxy-1-oxobutan-2-yl] acetate (PubChem CID 91163105) has the molecular formula C36H30F3NO6 and a molecular weight of 629.63 g/mol. Its IUPAC name is [1-[4-[[3-[3-benzyl-8-(trifluoromethyl)quinolin-4-yl]phenyl]methoxy]phenyl]peroxy-1-oxobutan-2-yl] acetate.
| Compound Name | [1-[4-[[3-[3-benzyl-8-(trifluoromethyl)quinolin-4-yl]phenyl]methoxy]phenyl]peroxy-1-oxobutan-2-yl] acetate |
|---|---|
| PubChem CID | 91163105 |
| Molecular Formula | C36H30F3NO6 |
| Molecular Weight | 629.63 g/mol |
| Exact Mass | 629.20 |
| IUPAC Name | [1-[4-[[3-[3-benzyl-8-(trifluoromethyl)quinolin-4-yl]phenyl]methoxy]phenyl]peroxy-1-oxobutan-2-yl] acetate |
| SMILES | CCC(OC(C)=O)C(=O)OOc1ccc(OCc2cccc(-c3c(Cc4ccccc4)cnc4c(C(F)(F)F)cccc34)c2)cc1 |
| InChI | InChI=1S/C36H30F3NO6/c1-3-32(44-23(2)41)35(42)46-45-29-17-15-28(16-18-29)43-22-25-11-7-12-26(20-25)33-27(19-24-9-5-4-6-10-24)21-40-34-30(33)13-8-14-31(34)36(37,38)39/h4-18,20-21,32H,3,19,22H2,1-2H3 |
| InChIKey | HOZDPHJDIMIQSU-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 83.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.63 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|