C36H31F3N2O4S — CID 25226504
(2S)-2-[[4-[[3-[3-benzyl-8-(trifluoromethyl)quinolin-4-yl]phenoxy]methyl]benzoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 25226504) has the molecular formula C36H31F3N2O4S and a molecular weight of 644.72 g/mol. Its IUPAC name is (2S)-2-[[4-[[3-[3-benzyl-8-(trifluoromethyl)quinolin-4-yl]phenoxy]methyl]benzoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[[4-[[3-[3-benzyl-8-(trifluoromethyl)quinolin-4-yl]phenoxy]methyl]benzoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 25226504 |
| Molecular Formula | C36H31F3N2O4S |
| Molecular Weight | 644.72 g/mol |
| Exact Mass | 644.20 |
| IUPAC Name | (2S)-2-[[4-[[3-[3-benzyl-8-(trifluoromethyl)quinolin-4-yl]phenoxy]methyl]benzoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NC(=O)c1ccc(COc2cccc(-c3c(Cc4ccccc4)cnc4c(C(F)(F)F)cccc34)c2)cc1)C(=O)O |
| InChI | InChI=1S/C36H31F3N2O4S/c1-46-18-17-31(35(43)44)41-34(42)25-15-13-24(14-16-25)22-45-28-10-5-9-26(20-28)32-27(19-23-7-3-2-4-8-23)21-40-33-29(32)11-6-12-30(33)36(37,38)39/h2-16,20-21,31H,17-19,22H2,1H3,(H,41,42)(H,43,44)/t31-/m0/s1 |
| InChIKey | UDGPVLZLNJNSOM-HKBQPEDESA-N |
| XLogP | 8.03 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.72 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'misc_aminoacid_A(1)', 'substructure': 'N/A'} |
|---|