C23H9F9O8S2 — CID 53391505
[9,10-dioxo-4-[3-(trifluoromethyl)phenyl]-1-(trifluoromethylsulfonyloxy)anthracen-2-yl] trifluoromethanesulfonate (PubChem CID 53391505) has the molecular formula C23H9F9O8S2 and a molecular weight of 648.43 g/mol. Its IUPAC name is [9,10-dioxo-4-[3-(trifluoromethyl)phenyl]-1-(trifluoromethylsulfonyloxy)anthracen-2-yl] trifluoromethanesulfonate.
| Compound Name | [9,10-dioxo-4-[3-(trifluoromethyl)phenyl]-1-(trifluoromethylsulfonyloxy)anthracen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 53391505 |
| Molecular Formula | C23H9F9O8S2 |
| Molecular Weight | 648.43 g/mol |
| Exact Mass | 647.96 |
| IUPAC Name | [9,10-dioxo-4-[3-(trifluoromethyl)phenyl]-1-(trifluoromethylsulfonyloxy)anthracen-2-yl] trifluoromethanesulfonate |
| SMILES | O=C1c2ccccc2C(=O)c2c(OS(=O)(=O)C(F)(F)F)c(OS(=O)(=O)C(F)(F)F)cc(-c3cccc(C(F)(F)F)c3)c21 |
| InChI | InChI=1S/C23H9F9O8S2/c24-21(25,26)11-5-3-4-10(8-11)14-9-15(39-41(35,36)22(27,28)29)20(40-42(37,38)23(30,31)32)17-16(14)18(33)12-6-1-2-7-13(12)19(17)34/h1-9H |
| InChIKey | GJIXBFPFZQSHEN-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.43 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|