C26H18F2O8S2 — CID 139085416
[1,8-bis(4-fluorobenzoyl)-7-methylsulfonyloxynaphthalen-2-yl] methanesulfonate (PubChem CID 139085416) has the molecular formula C26H18F2O8S2 and a molecular weight of 560.55 g/mol. Its IUPAC name is [1,8-bis(4-fluorobenzoyl)-7-methylsulfonyloxynaphthalen-2-yl] methanesulfonate.
| Compound Name | [1,8-bis(4-fluorobenzoyl)-7-methylsulfonyloxynaphthalen-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 139085416 |
| Molecular Formula | C26H18F2O8S2 |
| Molecular Weight | 560.55 g/mol |
| Exact Mass | 560.04 |
| IUPAC Name | [1,8-bis(4-fluorobenzoyl)-7-methylsulfonyloxynaphthalen-2-yl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1ccc2ccc(OS(C)(=O)=O)c(C(=O)c3ccc(F)cc3)c2c1C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H18F2O8S2/c1-37(31,32)35-20-13-7-15-8-14-21(36-38(2,33)34)24(26(30)17-5-11-19(28)12-6-17)22(15)23(20)25(29)16-3-9-18(27)10-4-16/h3-14H,1-2H3 |
| InChIKey | QTEODFLMYGMPSY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.55 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|