C26H18F6O8S2 — CID 53391502
[4-(4-tert-butylphenyl)-9,10-dioxo-1-(trifluoromethylsulfonyloxy)anthracen-2-yl] trifluoromethanesulfonate (PubChem CID 53391502) has the molecular formula C26H18F6O8S2 and a molecular weight of 636.54 g/mol. Its IUPAC name is [4-(4-tert-butylphenyl)-9,10-dioxo-1-(trifluoromethylsulfonyloxy)anthracen-2-yl] trifluoromethanesulfonate.
| Compound Name | [4-(4-tert-butylphenyl)-9,10-dioxo-1-(trifluoromethylsulfonyloxy)anthracen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 53391502 |
| Molecular Formula | C26H18F6O8S2 |
| Molecular Weight | 636.54 g/mol |
| Exact Mass | 636.03 |
| IUPAC Name | [4-(4-tert-butylphenyl)-9,10-dioxo-1-(trifluoromethylsulfonyloxy)anthracen-2-yl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)c1ccc(-c2cc(OS(=O)(=O)C(F)(F)F)c(OS(=O)(=O)C(F)(F)F)c3c2C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C26H18F6O8S2/c1-24(2,3)14-10-8-13(9-11-14)17-12-18(39-41(35,36)25(27,28)29)23(40-42(37,38)26(30,31)32)20-19(17)21(33)15-6-4-5-7-16(15)22(20)34/h4-12H,1-3H3 |
| InChIKey | LYIXNWRMBDKYJF-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.54 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|