C17H5F9O11S3 — CID 53392750
[9,10-dioxo-3,4-bis(trifluoromethylsulfonyloxy)anthracen-1-yl] trifluoromethanesulfonate (PubChem CID 53392750) has the molecular formula C17H5F9O11S3 and a molecular weight of 652.40 g/mol. Its IUPAC name is [9,10-dioxo-3,4-bis(trifluoromethylsulfonyloxy)anthracen-1-yl] trifluoromethanesulfonate.
| Compound Name | [9,10-dioxo-3,4-bis(trifluoromethylsulfonyloxy)anthracen-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 53392750 |
| Molecular Formula | C17H5F9O11S3 |
| Molecular Weight | 652.40 g/mol |
| Exact Mass | 651.89 |
| IUPAC Name | [9,10-dioxo-3,4-bis(trifluoromethylsulfonyloxy)anthracen-1-yl] trifluoromethanesulfonate |
| SMILES | O=C1c2ccccc2C(=O)c2c(OS(=O)(=O)C(F)(F)F)c(OS(=O)(=O)C(F)(F)F)cc(OS(=O)(=O)C(F)(F)F)c21 |
| InChI | InChI=1S/C17H5F9O11S3/c18-15(19,20)38(29,30)35-8-5-9(36-39(31,32)16(21,22)23)14(37-40(33,34)17(24,25)26)11-10(8)12(27)6-3-1-2-4-7(6)13(11)28/h1-5H |
| InChIKey | ROUFRMLWYXBVBF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 164.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|