C13H3F9O11S3 — CID 10698847
[5,8-dioxo-3,4-bis(trifluoromethylsulfonyloxy)naphthalen-1-yl] trifluoromethanesulfonate (PubChem CID 10698847) has the molecular formula C13H3F9O11S3 and a molecular weight of 602.34 g/mol. Its IUPAC name is [5,8-dioxo-3,4-bis(trifluoromethylsulfonyloxy)naphthalen-1-yl] trifluoromethanesulfonate.
| Compound Name | [5,8-dioxo-3,4-bis(trifluoromethylsulfonyloxy)naphthalen-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10698847 |
| Molecular Formula | C13H3F9O11S3 |
| Molecular Weight | 602.34 g/mol |
| Exact Mass | 601.87 |
| IUPAC Name | [5,8-dioxo-3,4-bis(trifluoromethylsulfonyloxy)naphthalen-1-yl] trifluoromethanesulfonate |
| SMILES | O=C1C=CC(=O)c2c(OS(=O)(=O)C(F)(F)F)c(OS(=O)(=O)C(F)(F)F)cc(OS(=O)(=O)C(F)(F)F)c21 |
| InChI | InChI=1S/C13H3F9O11S3/c14-11(15,16)34(25,26)31-6-3-7(32-35(27,28)12(17,18)19)10(33-36(29,30)13(20,21)22)9-5(24)2-1-4(23)8(6)9/h1-3H |
| InChIKey | FWRKSGNCRIJQHM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 164.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|