C15H7F3O7S — CID 15635773
(1,4-dihydroxy-9,10-dioxoanthracen-2-yl) trifluoromethanesulfonate (PubChem CID 15635773) has the molecular formula C15H7F3O7S and a molecular weight of 388.28 g/mol. Its IUPAC name is (1,4-dihydroxy-9,10-dioxoanthracen-2-yl) trifluoromethanesulfonate.
| Compound Name | (1,4-dihydroxy-9,10-dioxoanthracen-2-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 15635773 |
| Molecular Formula | C15H7F3O7S |
| Molecular Weight | 388.28 g/mol |
| Exact Mass | 387.99 |
| IUPAC Name | (1,4-dihydroxy-9,10-dioxoanthracen-2-yl) trifluoromethanesulfonate |
| SMILES | O=C1c2ccccc2C(=O)c2c(O)c(OS(=O)(=O)C(F)(F)F)cc(O)c21 |
| InChI | InChI=1S/C15H7F3O7S/c16-15(17,18)26(23,24)25-9-5-8(19)10-11(14(9)22)13(21)7-4-2-1-3-6(7)12(10)20/h1-5,19,22H |
| InChIKey | MMGSWBYOQOGVLI-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|