C16H6F6O8S2 — CID 52920669
[9,10-dioxo-4-(trifluoromethylsulfonyloxy)anthracen-2-yl] trifluoromethanesulfonate (PubChem CID 52920669) has the molecular formula C16H6F6O8S2 and a molecular weight of 504.34 g/mol. Its IUPAC name is [9,10-dioxo-4-(trifluoromethylsulfonyloxy)anthracen-2-yl] trifluoromethanesulfonate.
| Compound Name | [9,10-dioxo-4-(trifluoromethylsulfonyloxy)anthracen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 52920669 |
| Molecular Formula | C16H6F6O8S2 |
| Molecular Weight | 504.34 g/mol |
| Exact Mass | 503.94 |
| IUPAC Name | [9,10-dioxo-4-(trifluoromethylsulfonyloxy)anthracen-2-yl] trifluoromethanesulfonate |
| SMILES | O=C1c2ccccc2C(=O)c2c(OS(=O)(=O)C(F)(F)F)cc(OS(=O)(=O)C(F)(F)F)cc21 |
| InChI | InChI=1S/C16H6F6O8S2/c17-15(18,19)31(25,26)29-7-5-10-12(11(6-7)30-32(27,28)16(20,21)22)14(24)9-4-2-1-3-8(9)13(10)23/h1-6H |
| InChIKey | MSAYIMNQGZGDRR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|