C35H33F3O5S — CID 134958834
(5,11,17-tritert-butyl-14,22-dioxo-8-hexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-1(21),2,4,6,8,10,12,15,17,19-decaenyl) trifluoromethanesulfonate (PubChem CID 134958834) has the molecular formula C35H33F3O5S and a molecular weight of 622.71 g/mol. Its IUPAC name is (5,11,17-tritert-butyl-14,22-dioxo-8-hexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-1(21),2,4,6,8,10,12,15,17,19-decaenyl) trifluoromethanesulfonate.
| Compound Name | (5,11,17-tritert-butyl-14,22-dioxo-8-hexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-1(21),2,4,6,8,10,12,15,17,19-decaenyl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134958834 |
| Molecular Formula | C35H33F3O5S |
| Molecular Weight | 622.71 g/mol |
| Exact Mass | 622.20 |
| IUPAC Name | (5,11,17-tritert-butyl-14,22-dioxo-8-hexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-1(21),2,4,6,8,10,12,15,17,19-decaenyl) trifluoromethanesulfonate |
| SMILES | CC(C)(C)c1cc2c3c(c1)c(=O)c1cc(C(C)(C)C)cc4c(OS(=O)(=O)C(F)(F)F)c5cc(C(C)(C)C)cc(c2=O)c5c-3c41 |
| InChI | InChI=1S/C35H33F3O5S/c1-32(2,3)16-10-19-25-20(11-16)30(40)22-13-18(34(7,8)9)15-24-27(22)28(25)26-21(29(19)39)12-17(33(4,5)6)14-23(26)31(24)43-44(41,42)35(36,37)38/h10-15H,1-9H3 |
| InChIKey | HPSVTGRIVJKRQI-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.71 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|