C23H12F6O8S2 — CID 53391503
[4-(4-methylphenyl)-9,10-dioxo-1-(trifluoromethylsulfonyloxy)anthracen-2-yl] trifluoromethanesulfonate (PubChem CID 53391503) has the molecular formula C23H12F6O8S2 and a molecular weight of 594.46 g/mol. Its IUPAC name is [4-(4-methylphenyl)-9,10-dioxo-1-(trifluoromethylsulfonyloxy)anthracen-2-yl] trifluoromethanesulfonate.
| Compound Name | [4-(4-methylphenyl)-9,10-dioxo-1-(trifluoromethylsulfonyloxy)anthracen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 53391503 |
| Molecular Formula | C23H12F6O8S2 |
| Molecular Weight | 594.46 g/mol |
| Exact Mass | 593.99 |
| IUPAC Name | [4-(4-methylphenyl)-9,10-dioxo-1-(trifluoromethylsulfonyloxy)anthracen-2-yl] trifluoromethanesulfonate |
| SMILES | Cc1ccc(-c2cc(OS(=O)(=O)C(F)(F)F)c(OS(=O)(=O)C(F)(F)F)c3c2C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C23H12F6O8S2/c1-11-6-8-12(9-7-11)15-10-16(36-38(32,33)22(24,25)26)21(37-39(34,35)23(27,28)29)18-17(15)19(30)13-4-2-3-5-14(13)20(18)31/h2-10H,1H3 |
| InChIKey | DTXFVTHCHLXPKK-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|