About [8-(4-fluorobenzoyl)-2,7-dimethoxynaphthalen-1-yl]-(4-fluorophenyl)methanone
[8-(4-fluorobenzoyl)-2,7-dimethoxynaphthalen-1-yl]-(4-fluorophenyl)methanone (PubChem CID 102327200) has the molecular formula C26H18F2O4
and a molecular weight of 432.42 g/mol. Its IUPAC name is [8-(4-fluorobenzoyl)-2,7-dimethoxynaphthalen-1-yl]-(4-fluorophenyl)methanone.
Molecular Properties
| Compound Name | [8-(4-fluorobenzoyl)-2,7-dimethoxynaphthalen-1-yl]-(4-fluorophenyl)methanone |
| PubChem CID | 102327200 |
| Molecular Formula | C26H18F2O4 |
| Molecular Weight | 432.42 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | [8-(4-fluorobenzoyl)-2,7-dimethoxynaphthalen-1-yl]-(4-fluorophenyl)methanone |
| SMILES | COc1ccc2ccc(OC)c(C(=O)c3ccc(F)cc3)c2c1C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H18F2O4/c1-31-20-13-7-15-8-14-21(32-2)24(26(30)17-5-11-19(28)12-6-17)22(15)23(20)25(29)16-3-9-18(27)10-4-16/h3-14H,1-2H3 |
| InChIKey | CONHGNPPBKFFPZ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.42 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [8-(4-fluorobenzoyl)-2,7-dimethoxynaphthalen-1-yl]-(4-fluorophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [8-(4-fluorobenzoyl)-2,7-dimethoxynaphthalen-1-yl]-(4-fluorophenyl)methanone?
The IUPAC name of [8-(4-fluorobenzoyl)-2,7-dimethoxynaphthalen-1-yl]-(4-fluorophenyl)methanone (CID 102327200) is [8-(4-fluorobenzoyl)-2,7-dimethoxynaphthalen-1-yl]-(4-fluorophenyl)methanone.
What is the SMILES notation for [8-(4-fluorobenzoyl)-2,7-dimethoxynaphthalen-1-yl]-(4-fluorophenyl)methanone?
The canonical SMILES for [8-(4-fluorobenzoyl)-2,7-dimethoxynaphthalen-1-yl]-(4-fluorophenyl)methanone is COc1ccc2ccc(OC)c(C(=O)c3ccc(F)cc3)c2c1C(=O)c1ccc(F)cc1.
What is the InChIKey of [8-(4-fluorobenzoyl)-2,7-dimethoxynaphthalen-1-yl]-(4-fluorophenyl)methanone?
The InChIKey is CONHGNPPBKFFPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H18F2O4/c1-31-20-13-7-15-8-14-21(32-2)24(26(30)17-5-11-19(28)12-6-17)22(15)23(20)25(29)16-3-9-18(27)10-4-16/h3-14H,1-2H3.
What are the key properties of [8-(4-fluorobenzoyl)-2,7-dimethoxynaphthalen-1-yl]-(4-fluorophenyl)methanone?
[8-(4-fluorobenzoyl)-2,7-dimethoxynaphthalen-1-yl]-(4-fluorophenyl)methanone has a molecular weight of 432.42 g/mol, XLogP of 5.60, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [8-(4-fluorobenzoyl)-2,7-dimethoxynaphthalen-1-yl]-(4-fluorophenyl)methanone is sourced from PubChem (CID 102327200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).