C14H6F6O8S2 — CID 138978359
[3,7-diformyl-6-(trifluoromethylsulfonyloxy)naphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 138978359) has the molecular formula C14H6F6O8S2 and a molecular weight of 480.32 g/mol. Its IUPAC name is [3,7-diformyl-6-(trifluoromethylsulfonyloxy)naphthalen-2-yl] trifluoromethanesulfonate.
| Compound Name | [3,7-diformyl-6-(trifluoromethylsulfonyloxy)naphthalen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 138978359 |
| Molecular Formula | C14H6F6O8S2 |
| Molecular Weight | 480.32 g/mol |
| Exact Mass | 479.94 |
| IUPAC Name | [3,7-diformyl-6-(trifluoromethylsulfonyloxy)naphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | O=Cc1cc2cc(OS(=O)(=O)C(F)(F)F)c(C=O)cc2cc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C14H6F6O8S2/c15-13(16,17)29(23,24)27-11-4-8-2-10(6-22)12(3-7(8)1-9(11)5-21)28-30(25,26)14(18,19)20/h1-6H |
| InChIKey | VDVYGXMEZXTYAH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|