C15H15F3O6S — CID 89239977
2-[2-ethyl-1-oxo-6-(trifluoromethylsulfonyloxy)-3,4-dihydronaphthalen-2-yl]acetic acid (PubChem CID 89239977) has the molecular formula C15H15F3O6S and a molecular weight of 380.34 g/mol. Its IUPAC name is 2-[2-ethyl-1-oxo-6-(trifluoromethylsulfonyloxy)-3,4-dihydronaphthalen-2-yl]acetic acid.
| Compound Name | 2-[2-ethyl-1-oxo-6-(trifluoromethylsulfonyloxy)-3,4-dihydronaphthalen-2-yl]acetic acid |
|---|---|
| PubChem CID | 89239977 |
| Molecular Formula | C15H15F3O6S |
| Molecular Weight | 380.34 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | 2-[2-ethyl-1-oxo-6-(trifluoromethylsulfonyloxy)-3,4-dihydronaphthalen-2-yl]acetic acid |
| SMILES | CCC1(CC(=O)O)CCc2cc(OS(=O)(=O)C(F)(F)F)ccc2C1=O |
| InChI | InChI=1S/C15H15F3O6S/c1-2-14(8-12(19)20)6-5-9-7-10(3-4-11(9)13(14)21)24-25(22,23)15(16,17)18/h3-4,7H,2,5-6,8H2,1H3,(H,19,20) |
| InChIKey | TUGBLEUWVULKJH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|