C10H9AuOS — CID 59102233
gold(1+);4-oxo-2,3-dihydro-1H-naphthalene-2-thiolate (PubChem CID 59102233) has the molecular formula C10H9AuOS and a molecular weight of 374.22 g/mol. Its IUPAC name is gold(1+);4-oxo-2,3-dihydro-1H-naphthalene-2-thiolate.
| Compound Name | gold(1+);4-oxo-2,3-dihydro-1H-naphthalene-2-thiolate |
|---|---|
| PubChem CID | 59102233 |
| Molecular Formula | C10H9AuOS |
| Molecular Weight | 374.22 g/mol |
| Exact Mass | 374.00 |
| IUPAC Name | gold(1+);4-oxo-2,3-dihydro-1H-naphthalene-2-thiolate |
| SMILES | O=C1CC([S-])Cc2ccccc21.[Au+] |
| InChI | InChI=1S/C10H10OS.Au/c11-10-6-8(12)5-7-3-1-2-4-9(7)10;/h1-4,8,12H,5-6H2;/q;+1/p-1 |
| InChIKey | BSTQVEIVODEPFX-UHFFFAOYSA-M |
| XLogP | 1.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|