C16H15NO — CID 10609923
2-methyl-3-phenyl-3,4-dihydroisoquinolin-1-one (PubChem CID 10609923) has the molecular formula C16H15NO and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-methyl-3-phenyl-3,4-dihydroisoquinolin-1-one.
| Compound Name | 2-methyl-3-phenyl-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 10609923 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 2-methyl-3-phenyl-3,4-dihydroisoquinolin-1-one |
| SMILES | CN1C(=O)c2ccccc2CC1c1ccccc1 |
| InChI | InChI=1S/C16H15NO/c1-17-15(12-7-3-2-4-8-12)11-13-9-5-6-10-14(13)16(17)18/h2-10,15H,11H2,1H3 |
| InChIKey | ZMUXLFZXEWLBRZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |