C18H19NO2 — CID 142880307
(3R,7S)-4-methyl-3,7-diphenyl-1,4-oxazepan-5-one (PubChem CID 142880307) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is (3R,7S)-4-methyl-3,7-diphenyl-1,4-oxazepan-5-one.
| Compound Name | (3R,7S)-4-methyl-3,7-diphenyl-1,4-oxazepan-5-one |
|---|---|
| PubChem CID | 142880307 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (3R,7S)-4-methyl-3,7-diphenyl-1,4-oxazepan-5-one |
| SMILES | CN1C(=O)C[C@@H](c2ccccc2)OC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H19NO2/c1-19-16(14-8-4-2-5-9-14)13-21-17(12-18(19)20)15-10-6-3-7-11-15/h2-11,16-17H,12-13H2,1H3/t16-,17-/m0/s1 |
| InChIKey | JYDNZCFGAIRCLA-IRXDYDNUSA-N |
| XLogP | 3.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |