C24H22N2O2 — CID 101008767
(2R,6R)-1-benzoyl-3-methyl-2,6-diphenyl-1,3-diazinan-4-one (PubChem CID 101008767) has the molecular formula C24H22N2O2 and a molecular weight of 370.45 g/mol. Its IUPAC name is (2R,6R)-1-benzoyl-3-methyl-2,6-diphenyl-1,3-diazinan-4-one.
| Compound Name | (2R,6R)-1-benzoyl-3-methyl-2,6-diphenyl-1,3-diazinan-4-one |
|---|---|
| PubChem CID | 101008767 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | (2R,6R)-1-benzoyl-3-methyl-2,6-diphenyl-1,3-diazinan-4-one |
| SMILES | CN1C(=O)C[C@H](c2ccccc2)N(C(=O)c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C24H22N2O2/c1-25-22(27)17-21(18-11-5-2-6-12-18)26(23(25)19-13-7-3-8-14-19)24(28)20-15-9-4-10-16-20/h2-16,21,23H,17H2,1H3/t21-,23-/m1/s1 |
| InChIKey | BJXRTYSRJWRPNA-FYYLOGMGSA-N |
| XLogP | 4.43 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |