C18H14N2O2 — CID 110677837
N-(4-cyanophenyl)-4-oxo-2,3-dihydro-1H-naphthalene-2-carboxamide (PubChem CID 110677837) has the molecular formula C18H14N2O2 and a molecular weight of 290.32 g/mol. Its IUPAC name is N-(4-cyanophenyl)-4-oxo-2,3-dihydro-1H-naphthalene-2-carboxamide.
| Compound Name | N-(4-cyanophenyl)-4-oxo-2,3-dihydro-1H-naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 110677837 |
| Molecular Formula | C18H14N2O2 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | N-(4-cyanophenyl)-4-oxo-2,3-dihydro-1H-naphthalene-2-carboxamide |
| SMILES | N#Cc1ccc(NC(=O)C2CC(=O)c3ccccc3C2)cc1 |
| InChI | InChI=1S/C18H14N2O2/c19-11-12-5-7-15(8-6-12)20-18(22)14-9-13-3-1-2-4-16(13)17(21)10-14/h1-8,14H,9-10H2,(H,20,22) |
| InChIKey | YXAOVMJSYAYWEM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |