C17H15N3O — CID 65260692
N-(4-cyanophenyl)-1,2,3,4-tetrahydroisoquinoline-4-carboxamide (PubChem CID 65260692) has the molecular formula C17H15N3O and a molecular weight of 277.33 g/mol. Its IUPAC name is N-(4-cyanophenyl)-1,2,3,4-tetrahydroisoquinoline-4-carboxamide.
| Compound Name | N-(4-cyanophenyl)-1,2,3,4-tetrahydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 65260692 |
| Molecular Formula | C17H15N3O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | N-(4-cyanophenyl)-1,2,3,4-tetrahydroisoquinoline-4-carboxamide |
| SMILES | N#Cc1ccc(NC(=O)C2CNCc3ccccc32)cc1 |
| InChI | InChI=1S/C17H15N3O/c18-9-12-5-7-14(8-6-12)20-17(21)16-11-19-10-13-3-1-2-4-15(13)16/h1-8,16,19H,10-11H2,(H,20,21) |
| InChIKey | RDWSDBOCYTWWKC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |