C13H14N2O — CID 65260647
N-prop-2-ynyl-1,2,3,4-tetrahydroisoquinoline-4-carboxamide (PubChem CID 65260647) has the molecular formula C13H14N2O and a molecular weight of 214.27 g/mol. Its IUPAC name is N-prop-2-ynyl-1,2,3,4-tetrahydroisoquinoline-4-carboxamide.
| Compound Name | N-prop-2-ynyl-1,2,3,4-tetrahydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 65260647 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | N-prop-2-ynyl-1,2,3,4-tetrahydroisoquinoline-4-carboxamide |
| SMILES | C#CCNC(=O)C1CNCc2ccccc21 |
| InChI | InChI=1S/C13H14N2O/c1-2-7-15-13(16)12-9-14-8-10-5-3-4-6-11(10)12/h1,3-6,12,14H,7-9H2,(H,15,16) |
| InChIKey | NYZSPDLNRYBGFO-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|