C15H17NO — CID 116573369
1-(1,2,3,4-tetrahydroisoquinolin-4-yl)hex-5-yn-1-one (PubChem CID 116573369) has the molecular formula C15H17NO and a molecular weight of 227.31 g/mol. Its IUPAC name is 1-(1,2,3,4-tetrahydroisoquinolin-4-yl)hex-5-yn-1-one.
| Compound Name | 1-(1,2,3,4-tetrahydroisoquinolin-4-yl)hex-5-yn-1-one |
|---|---|
| PubChem CID | 116573369 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 1-(1,2,3,4-tetrahydroisoquinolin-4-yl)hex-5-yn-1-one |
| SMILES | C#CCCCC(=O)C1CNCc2ccccc21 |
| InChI | InChI=1S/C15H17NO/c1-2-3-4-9-15(17)14-11-16-10-12-7-5-6-8-13(12)14/h1,5-8,14,16H,3-4,9-11H2 |
| InChIKey | DOWHBXMLAKZALS-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|