C16H16N2O2 — CID 65260610
N-(4-hydroxyphenyl)-1,2,3,4-tetrahydroisoquinoline-4-carboxamide (PubChem CID 65260610) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)-1,2,3,4-tetrahydroisoquinoline-4-carboxamide.
| Compound Name | N-(4-hydroxyphenyl)-1,2,3,4-tetrahydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 65260610 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | N-(4-hydroxyphenyl)-1,2,3,4-tetrahydroisoquinoline-4-carboxamide |
| SMILES | O=C(Nc1ccc(O)cc1)C1CNCc2ccccc21 |
| InChI | InChI=1S/C16H16N2O2/c19-13-7-5-12(6-8-13)18-16(20)15-10-17-9-11-3-1-2-4-14(11)15/h1-8,15,17,19H,9-10H2,(H,18,20) |
| InChIKey | BUARTWKTQGCHDC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|