C17H14O3 — CID 45102125
(3S,4R)-3-benzoyl-4-hydroxy-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 45102125) has the molecular formula C17H14O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is (3S,4R)-3-benzoyl-4-hydroxy-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | (3S,4R)-3-benzoyl-4-hydroxy-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 45102125 |
| Molecular Formula | C17H14O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | (3S,4R)-3-benzoyl-4-hydroxy-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | O=C1C[C@H](C(=O)c2ccccc2)[C@@H](O)c2ccccc21 |
| InChI | InChI=1S/C17H14O3/c18-15-10-14(16(19)11-6-2-1-3-7-11)17(20)13-9-5-4-8-12(13)15/h1-9,14,17,20H,10H2/t14-,17+/m1/s1 |
| InChIKey | RCXLVYFPRIFCCM-PBHICJAKSA-N |
| XLogP | 2.81 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |