C17H14N2O2 — CID 99984654
(1R,3E,10bS)-3-hydrazinylidene-2,10b-dihydro-1H-fluoranthene-1-carboxylic acid (PubChem CID 99984654) has the molecular formula C17H14N2O2 and a molecular weight of 278.31 g/mol. Its IUPAC name is (1R,3E,10bS)-3-hydrazinylidene-2,10b-dihydro-1H-fluoranthene-1-carboxylic acid.
| Compound Name | (1R,3E,10bS)-3-hydrazinylidene-2,10b-dihydro-1H-fluoranthene-1-carboxylic acid |
|---|---|
| PubChem CID | 99984654 |
| Molecular Formula | C17H14N2O2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | (1R,3E,10bS)-3-hydrazinylidene-2,10b-dihydro-1H-fluoranthene-1-carboxylic acid |
| SMILES | N/N=C1\C[C@@H](C(=O)O)[C@H]2c3ccccc3-c3cccc1c32 |
| InChI | InChI=1S/C17H14N2O2/c18-19-14-8-13(17(20)21)16-10-5-2-1-4-9(10)11-6-3-7-12(14)15(11)16/h1-7,13,16H,8,18H2,(H,20,21)/b19-14+/t13-,16-/m1/s1 |
| InChIKey | UJTAOKCPHZWBHD-YXJZSKQOSA-N |
| XLogP | 2.57 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|