C26H23NO4 — CID 18650368
(2R,3S)-1-(9-phenyl-9H-fluoren-1-yl)piperidine-2,3-dicarboxylic acid (PubChem CID 18650368) has the molecular formula C26H23NO4 and a molecular weight of 413.47 g/mol. Its IUPAC name is (2R,3S)-1-(9-phenyl-9H-fluoren-1-yl)piperidine-2,3-dicarboxylic acid.
| Compound Name | (2R,3S)-1-(9-phenyl-9H-fluoren-1-yl)piperidine-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 18650368 |
| Molecular Formula | C26H23NO4 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | (2R,3S)-1-(9-phenyl-9H-fluoren-1-yl)piperidine-2,3-dicarboxylic acid |
| SMILES | O=C(O)[C@H]1CCCN(c2cccc3c2C(c2ccccc2)c2ccccc2-3)[C@H]1C(=O)O |
| InChI | InChI=1S/C26H23NO4/c28-25(29)20-13-7-15-27(24(20)26(30)31)21-14-6-12-19-17-10-4-5-11-18(17)22(23(19)21)16-8-2-1-3-9-16/h1-6,8-12,14,20,22,24H,7,13,15H2,(H,28,29)(H,30,31)/t20-,22?,24+/m0/s1 |
| InChIKey | KXOVXQPHXOUNJP-BRGACJNDSA-N |
| XLogP | 4.60 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |