C18H36 — CID 144583134
1,2-bis[(Z)-prop-1-enyl]cyclohexene;ethane (PubChem CID 144583134) has the molecular formula C18H36 and a molecular weight of 252.49 g/mol. Its IUPAC name is 1,2-bis[(Z)-prop-1-enyl]cyclohexene;ethane.
| Compound Name | 1,2-bis[(Z)-prop-1-enyl]cyclohexene;ethane |
|---|---|
| PubChem CID | 144583134 |
| Molecular Formula | C18H36 |
| Molecular Weight | 252.49 g/mol |
| Exact Mass | 252.28 |
| IUPAC Name | 1,2-bis[(Z)-prop-1-enyl]cyclohexene;ethane |
| SMILES | C/C=C\C1=C(/C=C\C)CCCC1.CC.CC.CC |
| InChI | InChI=1S/C12H18.3C2H6/c1-3-7-11-9-5-6-10-12(11)8-4-2;3*1-2/h3-4,7-8H,5-6,9-10H2,1-2H3;3*1-2H3/b7-3-,8-4-;;; |
| InChIKey | HAZDRCUWODWSKK-BWJZQZEJSA-N |
| XLogP | 7.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.49 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |