C12H20O — CID 145446824
4,5-bis[(Z)-prop-1-enyl]-2,3-dihydrofuran;ethane (PubChem CID 145446824) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is 4,5-bis[(Z)-prop-1-enyl]-2,3-dihydrofuran;ethane.
| Compound Name | 4,5-bis[(Z)-prop-1-enyl]-2,3-dihydrofuran;ethane |
|---|---|
| PubChem CID | 145446824 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | 4,5-bis[(Z)-prop-1-enyl]-2,3-dihydrofuran;ethane |
| SMILES | C/C=C\C1=C(/C=C\C)OCC1.CC |
| InChI | InChI=1S/C10H14O.C2H6/c1-3-5-9-7-8-11-10(9)6-4-2;1-2/h3-6H,7-8H2,1-2H3;1-2H3/b5-3-,6-4-; |
| InChIKey | BAMOKFFIWMVIEJ-VIOUERSGSA-N |
| XLogP | 3.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |