About Cyclopentabenzofuran
Cyclopentabenzofuran (PubChem CID 87131369) has the molecular formula C11H8O
and a molecular weight of 156.18 g/mol. Its IUPAC name is 2H-cyclopenta[g][1]benzofuran.
Molecular Properties
| Compound Name | Cyclopentabenzofuran |
| PubChem CID | 87131369 |
| Molecular Formula | C11H8O |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | 2H-cyclopenta[g][1]benzofuran |
| SMILES | C1C=C2C=CC3=CC=CC3=C2O1 |
| InChI | InChI=1S/C11H8O/c1-2-8-4-5-9-6-7-12-11(9)10(8)3-1/h1-6H,7H2 |
| InChIKey | SBRRDWKWIGRYCN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 9.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | 389 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze Cyclopentabenzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Cyclopentabenzofuran?
The IUPAC name of Cyclopentabenzofuran (CID 87131369) is 2H-cyclopenta[g][1]benzofuran.
What is the SMILES notation for Cyclopentabenzofuran?
The canonical SMILES for Cyclopentabenzofuran is C1C=C2C=CC3=CC=CC3=C2O1.
What is the InChIKey of Cyclopentabenzofuran?
The InChIKey is SBRRDWKWIGRYCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8O/c1-2-8-4-5-9-6-7-12-11(9)10(8)3-1/h1-6H,7H2.
What are the key properties of Cyclopentabenzofuran?
Cyclopentabenzofuran has a molecular weight of 156.18 g/mol, XLogP of 1.60, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Cyclopentabenzofuran is sourced from PubChem (CID 87131369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).