About 7,7a-Dihydrobenzofuran
7,7a-Dihydrobenzofuran (PubChem CID 19744327) has the molecular formula C8H8O
and a molecular weight of 120.15 g/mol. Its IUPAC name is 7,7a-dihydro-1-benzofuran.
Molecular Properties
| Compound Name | 7,7a-Dihydrobenzofuran |
| PubChem CID | 19744327 |
| Molecular Formula | C8H8O |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.06 |
| IUPAC Name | 7,7a-dihydro-1-benzofuran |
| SMILES | C1C=CC=C2C1OC=C2 |
| InChI | InChI=1S/C8H8O/c1-2-4-8-7(3-1)5-6-9-8/h1-3,5-6,8H,4H2 |
| InChIKey | WUCZQVYTWIYVQW-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 9.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | 199 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7,7a-Dihydrobenzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7a-Dihydrobenzofuran?
The IUPAC name of 7,7a-Dihydrobenzofuran (CID 19744327) is 7,7a-dihydro-1-benzofuran.
What is the SMILES notation for 7,7a-Dihydrobenzofuran?
The canonical SMILES for 7,7a-Dihydrobenzofuran is C1C=CC=C2C1OC=C2.
What is the InChIKey of 7,7a-Dihydrobenzofuran?
The InChIKey is WUCZQVYTWIYVQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O/c1-2-4-8-7(3-1)5-6-9-8/h1-3,5-6,8H,4H2.
What are the key properties of 7,7a-Dihydrobenzofuran?
7,7a-Dihydrobenzofuran has a molecular weight of 120.15 g/mol, XLogP of 1.50, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7a-Dihydrobenzofuran is sourced from PubChem (CID 19744327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).