About 4aH-benzo[c]chromene
4aH-benzo[c]chromene (PubChem CID 19702209) has the molecular formula C13H10O
and a molecular weight of 182.22 g/mol. Its IUPAC name is 4aH-benzo[c]chromene.
Molecular Properties
| Compound Name | 4aH-benzo[c]chromene |
| PubChem CID | 19702209 |
| Molecular Formula | C13H10O |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 4aH-benzo[c]chromene |
| SMILES | C1=CC2=c3ccccc3=COC2C=C1 |
| InChI | InChI=1S/C13H10O/c1-2-6-11-10(5-1)9-14-13-8-4-3-7-12(11)13/h1-9,13H |
| InChIKey | KDTQBESFYGHFDV-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4aH-benzo[c]chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4aH-benzo[c]chromene?
The IUPAC name of 4aH-benzo[c]chromene (CID 19702209) is 4aH-benzo[c]chromene.
What is the SMILES notation for 4aH-benzo[c]chromene?
The canonical SMILES for 4aH-benzo[c]chromene is C1=CC2=c3ccccc3=COC2C=C1.
What is the InChIKey of 4aH-benzo[c]chromene?
The InChIKey is KDTQBESFYGHFDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O/c1-2-6-11-10(5-1)9-14-13-8-4-3-7-12(11)13/h1-9,13H.
What are the key properties of 4aH-benzo[c]chromene?
4aH-benzo[c]chromene has a molecular weight of 182.22 g/mol, XLogP of 1.10, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4aH-benzo[c]chromene is sourced from PubChem (CID 19702209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).