About indeno[1,2-h]chromene
indeno[1,2-h]chromene (PubChem CID 22497284) has the molecular formula C16H10O
and a molecular weight of 218.25 g/mol. Its IUPAC name is indeno[1,2-h]chromene.
Molecular Properties
| Compound Name | indeno[1,2-h]chromene |
| PubChem CID | 22497284 |
| Molecular Formula | C16H10O |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | indeno[1,2-h]chromene |
| SMILES | c1ccc2c(c1)cc1c2ccc2cccoc21 |
| InChI | InChI=1S/C16H10O/c1-2-6-13-12(4-1)10-15-14(13)8-7-11-5-3-9-17-16(11)15/h1-10H |
| InChIKey | OOEAIXLASGCZOD-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze indeno[1,2-h]chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of indeno[1,2-h]chromene?
The IUPAC name of indeno[1,2-h]chromene (CID 22497284) is indeno[1,2-h]chromene.
What is the SMILES notation for indeno[1,2-h]chromene?
The canonical SMILES for indeno[1,2-h]chromene is c1ccc2c(c1)cc1c2ccc2cccoc21.
What is the InChIKey of indeno[1,2-h]chromene?
The InChIKey is OOEAIXLASGCZOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10O/c1-2-6-13-12(4-1)10-15-14(13)8-7-11-5-3-9-17-16(11)15/h1-10H.
What are the key properties of indeno[1,2-h]chromene?
indeno[1,2-h]chromene has a molecular weight of 218.25 g/mol, XLogP of 4.74, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for indeno[1,2-h]chromene is sourced from PubChem (CID 22497284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).