About cyclopenta[h]chromene
cyclopenta[h]chromene (PubChem CID 87622378) has the molecular formula C12H8O
and a molecular weight of 168.19 g/mol. Its IUPAC name is cyclopenta[h]chromene.
Molecular Properties
| Compound Name | cyclopenta[h]chromene |
| PubChem CID | 87622378 |
| Molecular Formula | C12H8O |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | cyclopenta[h]chromene |
| SMILES | c1coc2c(c1)ccc1cccc12 |
| InChI | InChI=1S/C12H8O/c1-3-9-6-7-10-4-2-8-13-12(10)11(9)5-1/h1-8H |
| InChIKey | JODAVNJGIAPNCE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cyclopenta[h]chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta[h]chromene?
The IUPAC name of cyclopenta[h]chromene (CID 87622378) is cyclopenta[h]chromene.
What is the SMILES notation for cyclopenta[h]chromene?
The canonical SMILES for cyclopenta[h]chromene is c1coc2c(c1)ccc1cccc12.
What is the InChIKey of cyclopenta[h]chromene?
The InChIKey is JODAVNJGIAPNCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8O/c1-3-9-6-7-10-4-2-8-13-12(10)11(9)5-1/h1-8H.
What are the key properties of cyclopenta[h]chromene?
cyclopenta[h]chromene has a molecular weight of 168.19 g/mol, XLogP of 3.59, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta[h]chromene is sourced from PubChem (CID 87622378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).