About 7-Oxabenzonorbornadiene
7-Oxabenzonorbornadiene (PubChem CID 129736041) has the molecular formula C10H8O
and a molecular weight of 144.17 g/mol. Its IUPAC name is 3-oxatricyclo[6.2.1.02,7]undeca-1(10),4,6,8-tetraene.
Molecular Properties
| Compound Name | 7-Oxabenzonorbornadiene |
| PubChem CID | 129736041 |
| Molecular Formula | C10H8O |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.06 |
| IUPAC Name | 3-oxatricyclo[6.2.1.02,7]undeca-1(10),4,6,8-tetraene |
| SMILES | C1C2=CC=C1C3=CC=COC23 |
| InChI | InChI=1S/C10H8O/c1-2-9-7-3-4-8(6-7)10(9)11-5-1/h1-5,10H,6H2 |
| InChIKey | DKHWIZINTJRXRE-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 9.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | 329 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-Oxabenzonorbornadiene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-Oxabenzonorbornadiene?
The IUPAC name of 7-Oxabenzonorbornadiene (CID 129736041) is 3-oxatricyclo[6.2.1.02,7]undeca-1(10),4,6,8-tetraene.
What is the SMILES notation for 7-Oxabenzonorbornadiene?
The canonical SMILES for 7-Oxabenzonorbornadiene is C1C2=CC=C1C3=CC=COC23.
What is the InChIKey of 7-Oxabenzonorbornadiene?
The InChIKey is DKHWIZINTJRXRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O/c1-2-9-7-3-4-8(6-7)10(9)11-5-1/h1-5,10H,6H2.
What are the key properties of 7-Oxabenzonorbornadiene?
7-Oxabenzonorbornadiene has a molecular weight of 144.17 g/mol, XLogP of 1.10, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-Oxabenzonorbornadiene is sourced from PubChem (CID 129736041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).