About cyclohepta[b]pyran
cyclohepta[b]pyran (PubChem CID 21477271) has the molecular formula C10H8O
and a molecular weight of 144.17 g/mol. Its IUPAC name is cyclohepta[b]pyran.
Molecular Properties
| Compound Name | cyclohepta[b]pyran |
| PubChem CID | 21477271 |
| Molecular Formula | C10H8O |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.06 |
| IUPAC Name | cyclohepta[b]pyran |
| SMILES | C1=CC=C2OC=CC=C2C=C1 |
| InChI | InChI=1S/C10H8O/c1-2-5-9-6-4-8-11-10(9)7-3-1/h1-8H |
| InChIKey | VZXFWKBBGXECNB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cyclohepta[b]pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohepta[b]pyran?
The IUPAC name of cyclohepta[b]pyran (CID 21477271) is cyclohepta[b]pyran.
What is the SMILES notation for cyclohepta[b]pyran?
The canonical SMILES for cyclohepta[b]pyran is C1=CC=C2OC=CC=C2C=C1.
What is the InChIKey of cyclohepta[b]pyran?
The InChIKey is VZXFWKBBGXECNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O/c1-2-5-9-6-4-8-11-10(9)7-3-1/h1-8H.
What are the key properties of cyclohepta[b]pyran?
cyclohepta[b]pyran has a molecular weight of 144.17 g/mol, XLogP of 2.47, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohepta[b]pyran is sourced from PubChem (CID 21477271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).