About lithium 1-methoxy-3,5-dimethylbenzene-4-ide
lithium 1-methoxy-3,5-dimethylbenzene-4-ide (PubChem CID 14943724) has the molecular formula C9H11LiO
and a molecular weight of 142.13 g/mol. Its IUPAC name is lithium 1-methoxy-3,5-dimethylbenzene-4-ide.
Molecular Properties
| Compound Name | lithium 1-methoxy-3,5-dimethylbenzene-4-ide |
| PubChem CID | 14943724 |
| Molecular Formula | C9H11LiO |
| Molecular Weight | 142.13 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | lithium 1-methoxy-3,5-dimethylbenzene-4-ide |
| SMILES | COc1cc(C)[c-]c(C)c1.[Li+] |
| InChI | InChI=1S/C9H11O.Li/c1-7-4-8(2)6-9(5-7)10-3;/h5-6H,1-3H3;/q-1;+1 |
| InChIKey | USCLXJWKBRJARL-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.13 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium 1-methoxy-3,5-dimethylbenzene-4-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 1-methoxy-3,5-dimethylbenzene-4-ide?
The IUPAC name of lithium 1-methoxy-3,5-dimethylbenzene-4-ide (CID 14943724) is lithium 1-methoxy-3,5-dimethylbenzene-4-ide.
What is the SMILES notation for lithium 1-methoxy-3,5-dimethylbenzene-4-ide?
The canonical SMILES for lithium 1-methoxy-3,5-dimethylbenzene-4-ide is COc1cc(C)[c-]c(C)c1.[Li+].
What is the InChIKey of lithium 1-methoxy-3,5-dimethylbenzene-4-ide?
The InChIKey is USCLXJWKBRJARL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11O.Li/c1-7-4-8(2)6-9(5-7)10-3;/h5-6H,1-3H3;/q-1;+1.
What are the key properties of lithium 1-methoxy-3,5-dimethylbenzene-4-ide?
lithium 1-methoxy-3,5-dimethylbenzene-4-ide has a molecular weight of 142.13 g/mol, XLogP of -0.88, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 1-methoxy-3,5-dimethylbenzene-4-ide is sourced from PubChem (CID 14943724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).